C11H18N3O2S+ — CID 2137937
6-(3-methoxypropyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one (PubChem CID 2137937) has the molecular formula C11H18N3O2S+ and a molecular weight of 256.35 g/mol. Its IUPAC name is 6-(3-methoxypropyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one.
| Compound Name | 6-(3-methoxypropyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one |
|---|---|
| PubChem CID | 2137937 |
| Molecular Formula | C11H18N3O2S+ |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 6-(3-methoxypropyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one |
| SMILES | COCCC[NH+]1CCc2[nH]c(=S)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C11H17N3O2S/c1-16-6-2-4-14-5-3-9-8(7-14)10(15)13-11(17)12-9/h2-7H2,1H3,(H2,12,13,15,17)/p+1 |
| InChIKey | JQIHSNMGBCBRFF-UHFFFAOYSA-O |
| XLogP | -0.59 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|