C24H23IN2O7S — CID 21382170
2-[4-[(E)-2-cyano-3-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3-oxoprop-1-enyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 21382170) has the molecular formula C24H23IN2O7S and a molecular weight of 610.43 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-3-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3-oxoprop-1-enyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-2-cyano-3-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3-oxoprop-1-enyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 21382170 |
| Molecular Formula | C24H23IN2O7S |
| Molecular Weight | 610.43 g/mol |
| Exact Mass | 610.03 |
| IUPAC Name | 2-[4-[(E)-2-cyano-3-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3-oxoprop-1-enyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2cc(I)c(OCC(=O)O)c(OC)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C24H23IN2O7S/c1-3-33-24(31)20-15-6-4-5-7-18(15)35-23(20)27-22(30)14(11-26)8-13-9-16(25)21(17(10-13)32-2)34-12-19(28)29/h8-10H,3-7,12H2,1-2H3,(H,27,30)(H,28,29)/b14-8+ |
| InChIKey | SMOXSQYGUJYMQO-RIYZIHGNSA-N |
| XLogP | 4.43 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|