C20H20FN5O5S — CID 21382993
2-[[4-ethyl-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 21382993) has the molecular formula C20H20FN5O5S and a molecular weight of 461.48 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 21382993 |
| Molecular Formula | C20H20FN5O5S |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-[[4-ethyl-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | CCn1c(COc2ccccc2F)nnc1SCC(=O)Nc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20FN5O5S/c1-3-25-18(11-31-17-7-5-4-6-14(17)21)23-24-20(25)32-12-19(27)22-15-9-8-13(30-2)10-16(15)26(28)29/h4-10H,3,11-12H2,1-2H3,(H,22,27) |
| InChIKey | DZLLYXRNSFVBQP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|