C14H11F3IN3OS — CID 21383049
N-(4-iodophenyl)-2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 21383049) has the molecular formula C14H11F3IN3OS and a molecular weight of 453.23 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-iodophenyl)-2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 21383049 |
| Molecular Formula | C14H11F3IN3OS |
| Molecular Weight | 453.23 g/mol |
| Exact Mass | 452.96 |
| IUPAC Name | N-(4-iodophenyl)-2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | Cc1cc(C(F)(F)F)nc(SCC(=O)Nc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C14H11F3IN3OS/c1-8-6-11(14(15,16)17)21-13(19-8)23-7-12(22)20-10-4-2-9(18)3-5-10/h2-6H,7H2,1H3,(H,20,22) |
| InChIKey | DNMIOPORRBUKBF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|