C30H23ClFN3O3S — CID 21384030
N-[(Z)-1-(2-chlorophenyl)-3-[4-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21384030) has the molecular formula C30H23ClFN3O3S and a molecular weight of 560.05 g/mol. Its IUPAC name is N-[(Z)-1-(2-chlorophenyl)-3-[4-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chlorophenyl)-3-[4-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21384030 |
| Molecular Formula | C30H23ClFN3O3S |
| Molecular Weight | 560.05 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | N-[(Z)-1-(2-chlorophenyl)-3-[4-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccccc2Cl)NC(=O)c2ccccc2)cc1)Nc1ccccc1F |
| InChI | InChI=1S/C30H23ClFN3O3S/c31-24-11-5-4-10-21(24)18-27(35-29(37)20-8-2-1-3-9-20)30(38)33-22-14-16-23(17-15-22)39-19-28(36)34-26-13-7-6-12-25(26)32/h1-18H,19H2,(H,33,38)(H,34,36)(H,35,37)/b27-18- |
| InChIKey | VKRXXGDWSOKASZ-IMRQLAEWSA-N |
| XLogP | 6.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.05 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|