C23H17FN2O3S2 — CID 2138487
[3-amino-4-(benzenesulfonyl)-5-(2-fluoroanilino)thiophen-2-yl]-phenylmethanone (PubChem CID 2138487) has the molecular formula C23H17FN2O3S2 and a molecular weight of 452.53 g/mol. Its IUPAC name is [3-amino-4-(benzenesulfonyl)-5-(2-fluoroanilino)thiophen-2-yl]-phenylmethanone.
| Compound Name | [3-amino-4-(benzenesulfonyl)-5-(2-fluoroanilino)thiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 2138487 |
| Molecular Formula | C23H17FN2O3S2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | [3-amino-4-(benzenesulfonyl)-5-(2-fluoroanilino)thiophen-2-yl]-phenylmethanone |
| SMILES | Nc1c(C(=O)c2ccccc2)sc(Nc2ccccc2F)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H17FN2O3S2/c24-17-13-7-8-14-18(17)26-23-22(31(28,29)16-11-5-2-6-12-16)19(25)21(30-23)20(27)15-9-3-1-4-10-15/h1-14,26H,25H2 |
| InChIKey | KGKOICOBGPGYGX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |