C19H18ClFN2O3S2 — CID 2138493
(3aR,6aR)-N-[(2-chloro-4-fluorophenyl)methyl]-N-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine (PubChem CID 2138493) has the molecular formula C19H18ClFN2O3S2 and a molecular weight of 440.95 g/mol. Its IUPAC name is (3aR,6aR)-N-[(2-chloro-4-fluorophenyl)methyl]-N-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine.
| Compound Name | (3aR,6aR)-N-[(2-chloro-4-fluorophenyl)methyl]-N-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 2138493 |
| Molecular Formula | C19H18ClFN2O3S2 |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | (3aR,6aR)-N-[(2-chloro-4-fluorophenyl)methyl]-N-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
| SMILES | COc1cccc(N(Cc2ccc(F)cc2Cl)C2=N[C@@H]3CS(=O)(=O)C[C@@H]3S2)c1 |
| InChI | InChI=1S/C19H18ClFN2O3S2/c1-26-15-4-2-3-14(8-15)23(9-12-5-6-13(21)7-16(12)20)19-22-17-10-28(24,25)11-18(17)27-19/h2-8,17-18H,9-11H2,1H3/t17-,18+/m1/s1 |
| InChIKey | PZBOWRZTCMVEPE-MSOLQXFVSA-N |
| XLogP | 3.76 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |