C14H24O3 — CID 21387317
4-(4-methylpentyl)-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxin-2-one (PubChem CID 21387317) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 4-(4-methylpentyl)-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxin-2-one.
| Compound Name | 4-(4-methylpentyl)-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxin-2-one |
|---|---|
| PubChem CID | 21387317 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-(4-methylpentyl)-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxin-2-one |
| SMILES | CC(C)CCCC1OC(=O)OC2CCCCC21 |
| InChI | InChI=1S/C14H24O3/c1-10(2)6-5-9-13-11-7-3-4-8-12(11)16-14(15)17-13/h10-13H,3-9H2,1-2H3 |
| InChIKey | YNELXGNCALAOKR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |