C11H8Cl2O2 — CID 21387725
(2,5-dichlorophenyl)-(furan-2-yl)methanol (PubChem CID 21387725) has the molecular formula C11H8Cl2O2 and a molecular weight of 243.09 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(furan-2-yl)methanol.
| Compound Name | (2,5-dichlorophenyl)-(furan-2-yl)methanol |
|---|---|
| PubChem CID | 21387725 |
| Molecular Formula | C11H8Cl2O2 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (2,5-dichlorophenyl)-(furan-2-yl)methanol |
| SMILES | OC(c1ccco1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H8Cl2O2/c12-7-3-4-9(13)8(6-7)11(14)10-2-1-5-15-10/h1-6,11,14H |
| InChIKey | FYUVJLNDKRFXCV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |