About cyclohexa-2,5-diene-1,4-diimine;hydrochloride
cyclohexa-2,5-diene-1,4-diimine;hydrochloride (PubChem CID 21387999) has the molecular formula C6H7ClN2
and a molecular weight of 142.59 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-diimine;hydrochloride.
Molecular Properties
| Compound Name | cyclohexa-2,5-diene-1,4-diimine;hydrochloride |
| PubChem CID | 21387999 |
| Molecular Formula | C6H7ClN2 |
| Molecular Weight | 142.59 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-diimine;hydrochloride |
| SMILES | Cl.[H]N=C1C=CC(=N[H])C=C1 |
| InChI | InChI=1S/C6H6N2.ClH/c7-5-1-2-6(8)4-3-5;/h1-4,7-8H;1H/b7-5-,8-6+; |
| InChIKey | XIVBDABVEWLQMV-KHCQPJBVSA-N |
| XLogP | 1.57 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.59 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,5-diene-1,4-diimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,5-diene-1,4-diimine;hydrochloride?
The IUPAC name of cyclohexa-2,5-diene-1,4-diimine;hydrochloride (CID 21387999) is cyclohexa-2,5-diene-1,4-diimine;hydrochloride.
What is the SMILES notation for cyclohexa-2,5-diene-1,4-diimine;hydrochloride?
The canonical SMILES for cyclohexa-2,5-diene-1,4-diimine;hydrochloride is Cl.[H]N=C1C=CC(=N[H])C=C1.
What is the InChIKey of cyclohexa-2,5-diene-1,4-diimine;hydrochloride?
The InChIKey is XIVBDABVEWLQMV-KHCQPJBVSA-N. The full InChI is InChI=1S/C6H6N2.ClH/c7-5-1-2-6(8)4-3-5;/h1-4,7-8H;1H/b7-5-,8-6+;.
What are the key properties of cyclohexa-2,5-diene-1,4-diimine;hydrochloride?
cyclohexa-2,5-diene-1,4-diimine;hydrochloride has a molecular weight of 142.59 g/mol, XLogP of 1.57, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,5-diene-1,4-diimine;hydrochloride is sourced from PubChem (CID 21387999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).