C12H14N2 — CID 21388015
2,4,5-trimethylquinolin-8-amine (PubChem CID 21388015) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2,4,5-trimethylquinolin-8-amine.
| Compound Name | 2,4,5-trimethylquinolin-8-amine |
|---|---|
| PubChem CID | 21388015 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2,4,5-trimethylquinolin-8-amine |
| SMILES | Cc1cc(C)c2c(C)ccc(N)c2n1 |
| InChI | InChI=1S/C12H14N2/c1-7-4-5-10(13)12-11(7)8(2)6-9(3)14-12/h4-6H,13H2,1-3H3 |
| InChIKey | RSELVIMARKUGRN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|