C14H10N6O2 — CID 21388241
1,2,4-benzotriazine;1-oxido-2H-1,2,4-benzotriazin-1-ium-3-one (PubChem CID 21388241) has the molecular formula C14H10N6O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 1,2,4-benzotriazine;1-oxido-2H-1,2,4-benzotriazin-1-ium-3-one.
| Compound Name | 1,2,4-benzotriazine;1-oxido-2H-1,2,4-benzotriazin-1-ium-3-one |
|---|---|
| PubChem CID | 21388241 |
| Molecular Formula | C14H10N6O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1,2,4-benzotriazine;1-oxido-2H-1,2,4-benzotriazin-1-ium-3-one |
| SMILES | O=c1nc2ccccc2[n+]([O-])[nH]1.c1ccc2nncnc2c1 |
| InChI | InChI=1S/C7H5N3O2.C7H5N3/c11-7-8-5-3-1-2-4-6(5)10(12)9-7;1-2-4-7-6(3-1)8-5-9-10-7/h1-4H,(H,8,9,11);1-5H |
| InChIKey | APIYYKDORNJJOH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|