About S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride
S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride (PubChem CID 21388369) has the molecular formula C16H22ClN3O2S
and a molecular weight of 355.89 g/mol. Its IUPAC name is S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride.
Molecular Properties
| Compound Name | S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride |
| PubChem CID | 21388369 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride |
| SMILES | CC(Cc1nc(-c2ccccc2)no1)C(=O)SC(C)N(C)C.Cl |
| InChI | InChI=1S/C16H21N3O2S.ClH/c1-11(16(20)22-12(2)19(3)4)10-14-17-15(18-21-14)13-8-6-5-7-9-13;/h5-9,11-12H,10H2,1-4H3;1H |
| InChIKey | DRHPFDYKUCQZEA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride?
The IUPAC name of S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride (CID 21388369) is S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride.
What is the SMILES notation for S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride?
The canonical SMILES for S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride is CC(Cc1nc(-c2ccccc2)no1)C(=O)SC(C)N(C)C.Cl.
What is the InChIKey of S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride?
The InChIKey is DRHPFDYKUCQZEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2S.ClH/c1-11(16(20)22-12(2)19(3)4)10-14-17-15(18-21-14)13-8-6-5-7-9-13;/h5-9,11-12H,10H2,1-4H3;1H.
What are the key properties of S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride?
S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride has a molecular weight of 355.89 g/mol, XLogP of 3.50, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[1-(dimethylamino)ethyl] 2-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanethioate;hydrochloride is sourced from PubChem (CID 21388369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).