About ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate
ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate (PubChem CID 21388460) has the molecular formula C19H27N3O4
and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate |
| PubChem CID | 21388460 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(C#N)(CC)c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-5-19(14-20,15-7-8-16(24-3)17(13-15)25-4)22-11-9-21(10-12-22)18(23)26-6-2/h7-8,13H,5-6,9-12H2,1-4H3 |
| InChIKey | JLGPOHGWCIYERP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate (CID 21388460) is ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C(C#N)(CC)c2ccc(OC)c(OC)c2)CC1.
What is the InChIKey of ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate?
The InChIKey is JLGPOHGWCIYERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O4/c1-5-19(14-20,15-7-8-16(24-3)17(13-15)25-4)22-11-9-21(10-12-22)18(23)26-6-2/h7-8,13H,5-6,9-12H2,1-4H3.
What are the key properties of ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate?
ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate has a molecular weight of 361.44 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[1-cyano-1-(3,4-dimethoxyphenyl)propyl]piperazine-1-carboxylate is sourced from PubChem (CID 21388460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).