About 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine
2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine (PubChem CID 21388671) has the molecular formula C7H9Cl2N3O
and a molecular weight of 222.07 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine.
Molecular Properties
| Compound Name | 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine |
| PubChem CID | 21388671 |
| Molecular Formula | C7H9Cl2N3O |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine |
| SMILES | NCCOc1ncc(Cl)c(N)c1Cl |
| InChI | InChI=1S/C7H9Cl2N3O/c8-4-3-12-7(13-2-1-10)5(9)6(4)11/h3H,1-2,10H2,(H2,11,12) |
| InChIKey | AIBQBNMRMDTPFE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine?
The IUPAC name of 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine (CID 21388671) is 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine.
What is the SMILES notation for 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine?
The canonical SMILES for 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine is NCCOc1ncc(Cl)c(N)c1Cl.
What is the InChIKey of 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine?
The InChIKey is AIBQBNMRMDTPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2N3O/c8-4-3-12-7(13-2-1-10)5(9)6(4)11/h3H,1-2,10H2,(H2,11,12).
What are the key properties of 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine?
2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine has a molecular weight of 222.07 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)-3,5-dichloropyridin-4-amine is sourced from PubChem (CID 21388671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).