C11H9N5O2 — CID 21389170
10-amino-8-methyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-11-carboxylic acid (PubChem CID 21389170) has the molecular formula C11H9N5O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is 10-amino-8-methyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-11-carboxylic acid.
| Compound Name | 10-amino-8-methyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-11-carboxylic acid |
|---|---|
| PubChem CID | 21389170 |
| Molecular Formula | C11H9N5O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 10-amino-8-methyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-11-carboxylic acid |
| SMILES | Cc1nc2ccnn2c2ncc(C(=O)O)c(N)c12 |
| InChI | InChI=1S/C11H9N5O2/c1-5-8-9(12)6(11(17)18)4-13-10(8)16-7(15-5)2-3-14-16/h2-4H,1H3,(H2,12,13)(H,17,18) |
| InChIKey | UTBLERJZZLJGCE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |