C17H21N5O3 — CID 21389171
10-[3-(dimethylamino)propoxy]-4,8-dimethyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-11-carboxylic acid (PubChem CID 21389171) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 10-[3-(dimethylamino)propoxy]-4,8-dimethyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-11-carboxylic acid.
| Compound Name | 10-[3-(dimethylamino)propoxy]-4,8-dimethyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-11-carboxylic acid |
|---|---|
| PubChem CID | 21389171 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 10-[3-(dimethylamino)propoxy]-4,8-dimethyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-11-carboxylic acid |
| SMILES | Cc1cc2nc(C)c3c(OCCCN(C)C)c(C(=O)O)cnc3n2n1 |
| InChI | InChI=1S/C17H21N5O3/c1-10-8-13-19-11(2)14-15(25-7-5-6-21(3)4)12(17(23)24)9-18-16(14)22(13)20-10/h8-9H,5-7H2,1-4H3,(H,23,24) |
| InChIKey | ZWXZRPFNEBCGLH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|