C23H34O4 — CID 21389407
acetyl (2E,5E,8E)-7-methoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5,8-trienoate (PubChem CID 21389407) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is acetyl (2E,5E,8E)-7-methoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5,8-trienoate.
| Compound Name | acetyl (2E,5E,8E)-7-methoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5,8-trienoate |
|---|---|
| PubChem CID | 21389407 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | acetyl (2E,5E,8E)-7-methoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5,8-trienoate |
| SMILES | COC(C)(/C=C/C/C(C)=C/C(=O)OC(C)=O)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H34O4/c1-17(16-21(25)27-19(3)24)10-8-14-23(6,26-7)15-12-20-18(2)11-9-13-22(20,4)5/h8,12,14-16H,9-11,13H2,1-7H3/b14-8+,15-12+,17-16+ |
| InChIKey | DCVCDLXEUHHZRF-HIZDWDCBSA-N |
| XLogP | 5.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|