C24H36O4 — CID 21389409
acetyl (2E,5E,8E)-7-ethoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5,8-trienoate (PubChem CID 21389409) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is acetyl (2E,5E,8E)-7-ethoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5,8-trienoate.
| Compound Name | acetyl (2E,5E,8E)-7-ethoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5,8-trienoate |
|---|---|
| PubChem CID | 21389409 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | acetyl (2E,5E,8E)-7-ethoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,5,8-trienoate |
| SMILES | CCOC(C)(/C=C/C/C(C)=C/C(=O)OC(C)=O)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C24H36O4/c1-8-27-24(7,15-9-11-18(2)17-22(26)28-20(4)25)16-13-21-19(3)12-10-14-23(21,5)6/h9,13,15-17H,8,10-12,14H2,1-7H3/b15-9+,16-13+,18-17+ |
| InChIKey | KJVMYICWKIESGC-MZXHXFCKSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|