About 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol
4-(benzotriazol-2-yl)-2,5-dimethoxyphenol (PubChem CID 21390051) has the molecular formula C14H13N3O3
and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol |
| PubChem CID | 21390051 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol |
| SMILES | COc1cc(-n2nc3ccccc3n2)c(OC)cc1O |
| InChI | InChI=1S/C14H13N3O3/c1-19-13-8-12(18)14(20-2)7-11(13)17-15-9-5-3-4-6-10(9)16-17/h3-8,18H,1-2H3 |
| InChIKey | VWSGQRJGAQINBQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol?
The IUPAC name of 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol (CID 21390051) is 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol.
What is the SMILES notation for 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol?
The canonical SMILES for 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol is COc1cc(-n2nc3ccccc3n2)c(OC)cc1O.
What is the InChIKey of 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol?
The InChIKey is VWSGQRJGAQINBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3/c1-19-13-8-12(18)14(20-2)7-11(13)17-15-9-5-3-4-6-10(9)16-17/h3-8,18H,1-2H3.
What are the key properties of 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol?
4-(benzotriazol-2-yl)-2,5-dimethoxyphenol has a molecular weight of 271.28 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzotriazol-2-yl)-2,5-dimethoxyphenol is sourced from PubChem (CID 21390051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).