C30H56N2O2 — CID 21390620
2-[2-[1,7-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)heptan-4-ylamino]ethylamino]propane-1,3-diol (PubChem CID 21390620) has the molecular formula C30H56N2O2 and a molecular weight of 476.79 g/mol. Its IUPAC name is 2-[2-[1,7-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)heptan-4-ylamino]ethylamino]propane-1,3-diol.
| Compound Name | 2-[2-[1,7-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)heptan-4-ylamino]ethylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 21390620 |
| Molecular Formula | C30H56N2O2 |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 476.43 |
| IUPAC Name | 2-[2-[1,7-bis(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)heptan-4-ylamino]ethylamino]propane-1,3-diol |
| SMILES | CC1(C)C2CCC(C2)C1CCCC(CCCC1C2CCC(C2)C1(C)C)NCCNC(CO)CO |
| InChI | InChI=1S/C30H56N2O2/c1-29(2)23-13-11-21(17-23)27(29)9-5-7-25(31-15-16-32-26(19-33)20-34)8-6-10-28-22-12-14-24(18-22)30(28,3)4/h21-28,31-34H,5-20H2,1-4H3 |
| InChIKey | FSXMXHCUHDJLTN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|