C25H28F3N3 — CID 21391095
(7E)-7-benzylidene-5-butyl-3-phenyl-2-(2,2,2-trifluoroethyl)-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 21391095) has the molecular formula C25H28F3N3 and a molecular weight of 427.51 g/mol. Its IUPAC name is (7E)-7-benzylidene-5-butyl-3-phenyl-2-(2,2,2-trifluoroethyl)-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | (7E)-7-benzylidene-5-butyl-3-phenyl-2-(2,2,2-trifluoroethyl)-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 21391095 |
| Molecular Formula | C25H28F3N3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (7E)-7-benzylidene-5-butyl-3-phenyl-2-(2,2,2-trifluoroethyl)-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CCCCN1C/C(=C\c2ccccc2)C2=NN(CC(F)(F)F)C(c3ccccc3)C2C1 |
| InChI | InChI=1S/C25H28F3N3/c1-2-3-14-30-16-21(15-19-10-6-4-7-11-19)23-22(17-30)24(20-12-8-5-9-13-20)31(29-23)18-25(26,27)28/h4-13,15,22,24H,2-3,14,16-18H2,1H3/b21-15+ |
| InChIKey | JPTTVEYZZHVBML-RCCKNPSSSA-N |
| XLogP | 5.78 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |