About 1-acetyl-3,5-dimethylimidazolidine-2,4-dione
1-acetyl-3,5-dimethylimidazolidine-2,4-dione (PubChem CID 21391552) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-acetyl-3,5-dimethylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-acetyl-3,5-dimethylimidazolidine-2,4-dione |
| PubChem CID | 21391552 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1-acetyl-3,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC(=O)N1C(=O)N(C)C(=O)C1C |
| InChI | InChI=1S/C7H10N2O3/c1-4-6(11)8(3)7(12)9(4)5(2)10/h4H,1-3H3 |
| InChIKey | HOWSHXLDTVNHSW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyl-3,5-dimethylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-3,5-dimethylimidazolidine-2,4-dione?
The IUPAC name of 1-acetyl-3,5-dimethylimidazolidine-2,4-dione (CID 21391552) is 1-acetyl-3,5-dimethylimidazolidine-2,4-dione.
What is the SMILES notation for 1-acetyl-3,5-dimethylimidazolidine-2,4-dione?
The canonical SMILES for 1-acetyl-3,5-dimethylimidazolidine-2,4-dione is CC(=O)N1C(=O)N(C)C(=O)C1C.
What is the InChIKey of 1-acetyl-3,5-dimethylimidazolidine-2,4-dione?
The InChIKey is HOWSHXLDTVNHSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-4-6(11)8(3)7(12)9(4)5(2)10/h4H,1-3H3.
What are the key properties of 1-acetyl-3,5-dimethylimidazolidine-2,4-dione?
1-acetyl-3,5-dimethylimidazolidine-2,4-dione has a molecular weight of 170.17 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-3,5-dimethylimidazolidine-2,4-dione is sourced from PubChem (CID 21391552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).