C22H22N2O4 — CID 21392148
1,8-diethyl-15-methyl-15-azatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaene-4-carbonitrile;oxalic acid (PubChem CID 21392148) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1,8-diethyl-15-methyl-15-azatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaene-4-carbonitrile;oxalic acid.
| Compound Name | 1,8-diethyl-15-methyl-15-azatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaene-4-carbonitrile;oxalic acid |
|---|---|
| PubChem CID | 21392148 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1,8-diethyl-15-methyl-15-azatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaene-4-carbonitrile;oxalic acid |
| SMILES | CCC12c3ccccc3C(CC)(c3cc(C#N)ccc31)N2C.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H20N2.C2H2O4/c1-4-19-15-8-6-7-9-16(15)20(5-2,22(19)3)18-12-14(13-21)10-11-17(18)19;3-1(4)2(5)6/h6-12H,4-5H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | FUNVAWSBTVXDCS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|