C16H10N2O8 — CID 21392539
5-methyl-4,6-dioxo-1,9-dihydropyrido[3,2-g]quinoline-2,8,10-tricarboxylic acid (PubChem CID 21392539) has the molecular formula C16H10N2O8 and a molecular weight of 358.26 g/mol. Its IUPAC name is 5-methyl-4,6-dioxo-1,9-dihydropyrido[3,2-g]quinoline-2,8,10-tricarboxylic acid.
| Compound Name | 5-methyl-4,6-dioxo-1,9-dihydropyrido[3,2-g]quinoline-2,8,10-tricarboxylic acid |
|---|---|
| PubChem CID | 21392539 |
| Molecular Formula | C16H10N2O8 |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 5-methyl-4,6-dioxo-1,9-dihydropyrido[3,2-g]quinoline-2,8,10-tricarboxylic acid |
| SMILES | Cc1c2c(=O)cc(C(=O)O)[nH]c2c(C(=O)O)c2[nH]c(C(=O)O)cc(=O)c12 |
| InChI | InChI=1S/C16H10N2O8/c1-4-9-7(19)2-5(14(21)22)17-12(9)11(16(25)26)13-10(4)8(20)3-6(18-13)15(23)24/h2-3H,1H3,(H,17,19)(H,18,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | YNNVQSNMGOYHEU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 177.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|