C9H6ClN3S — CID 21392799
1-(chloromethyl)-[1,2,4]triazolo[3,4-b][1,3]benzothiazole (PubChem CID 21392799) has the molecular formula C9H6ClN3S and a molecular weight of 223.69 g/mol. Its IUPAC name is 1-(chloromethyl)-[1,2,4]triazolo[3,4-b][1,3]benzothiazole.
| Compound Name | 1-(chloromethyl)-[1,2,4]triazolo[3,4-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 21392799 |
| Molecular Formula | C9H6ClN3S |
| Molecular Weight | 223.69 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 1-(chloromethyl)-[1,2,4]triazolo[3,4-b][1,3]benzothiazole |
| SMILES | ClCc1nnc2sc3ccccc3n12 |
| InChI | InChI=1S/C9H6ClN3S/c10-5-8-11-12-9-13(8)6-3-1-2-4-7(6)14-9/h1-4H,5H2 |
| InChIKey | GIXAMMNDIQSYGT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|