About 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine
4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine (PubChem CID 21392988) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine |
| PubChem CID | 21392988 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine |
| SMILES | C1COC(N2CCOCC2)=N1 |
| InChI | InChI=1S/C7H12N2O2/c1-4-11-7(8-1)9-2-5-10-6-3-9/h1-6H2 |
| InChIKey | ICFHSWCDTICIIC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine?
The IUPAC name of 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine (CID 21392988) is 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine.
What is the SMILES notation for 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine?
The canonical SMILES for 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine is C1COC(N2CCOCC2)=N1.
What is the InChIKey of 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine?
The InChIKey is ICFHSWCDTICIIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-4-11-7(8-1)9-2-5-10-6-3-9/h1-6H2.
What are the key properties of 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine?
4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine has a molecular weight of 156.18 g/mol, XLogP of -0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1,3-oxazol-2-yl)morpholine is sourced from PubChem (CID 21392988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).