About [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 21393370) has the molecular formula C19H21N5O3S
and a molecular weight of 399.48 g/mol. Its IUPAC name is [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
| PubChem CID | 21393370 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | COc1cc2nc(N3CCN(C(=O)c4cccs4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C19H21N5O3S/c1-26-14-10-12-13(11-15(14)27-2)21-19(22-17(12)20)24-7-5-23(6-8-24)18(25)16-4-3-9-28-16/h3-4,9-11H,5-8H2,1-2H3,(H2,20,21,22) |
| InChIKey | UPAUPEZHEAXKMN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone?
The IUPAC name of [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone (CID 21393370) is [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone is COc1cc2nc(N3CCN(C(=O)c4cccs4)CC3)nc(N)c2cc1OC.
What is the InChIKey of [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone?
The InChIKey is UPAUPEZHEAXKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3S/c1-26-14-10-12-13(11-15(14)27-2)21-19(22-17(12)20)24-7-5-23(6-8-24)18(25)16-4-3-9-28-16/h3-4,9-11H,5-8H2,1-2H3,(H2,20,21,22).
What are the key properties of [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone?
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone has a molecular weight of 399.48 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 21393370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).