C9H4Cl5NO2S — CID 21393508
4,4,5,5-tetrachloro-2-(3-chlorophenyl)-1-oxo-1,2-thiazolidin-3-one (PubChem CID 21393508) has the molecular formula C9H4Cl5NO2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4,4,5,5-tetrachloro-2-(3-chlorophenyl)-1-oxo-1,2-thiazolidin-3-one.
| Compound Name | 4,4,5,5-tetrachloro-2-(3-chlorophenyl)-1-oxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 21393508 |
| Molecular Formula | C9H4Cl5NO2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 364.84 |
| IUPAC Name | 4,4,5,5-tetrachloro-2-(3-chlorophenyl)-1-oxo-1,2-thiazolidin-3-one |
| SMILES | O=C1N(c2cccc(Cl)c2)S(=O)C(Cl)(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C9H4Cl5NO2S/c10-5-2-1-3-6(4-5)15-7(16)8(11,12)9(13,14)18(15)17/h1-4H |
| InChIKey | QMNNJQTULAJRRF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|