C18H16ClNO — CID 21393601
6-(4-chlorophenyl)-2,3,4,9-tetrahydro-1H-carbazol-3-ol (PubChem CID 21393601) has the molecular formula C18H16ClNO and a molecular weight of 297.79 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2,3,4,9-tetrahydro-1H-carbazol-3-ol.
| Compound Name | 6-(4-chlorophenyl)-2,3,4,9-tetrahydro-1H-carbazol-3-ol |
|---|---|
| PubChem CID | 21393601 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 6-(4-chlorophenyl)-2,3,4,9-tetrahydro-1H-carbazol-3-ol |
| SMILES | OC1CCc2[nH]c3ccc(-c4ccc(Cl)cc4)cc3c2C1 |
| InChI | InChI=1S/C18H16ClNO/c19-13-4-1-11(2-5-13)12-3-7-17-15(9-12)16-10-14(21)6-8-18(16)20-17/h1-5,7,9,14,20-21H,6,8,10H2 |
| InChIKey | AIHBFXSTXZAQPE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|