About 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline
8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 21393808) has the molecular formula C9H9ClN2O2
and a molecular weight of 212.64 g/mol. Its IUPAC name is 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline |
| PubChem CID | 21393808 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | O=[N+]([O-])c1ccc2c(c1Cl)CNCC2 |
| InChI | InChI=1S/C9H9ClN2O2/c10-9-7-5-11-4-3-6(7)1-2-8(9)12(13)14/h1-2,11H,3-5H2 |
| InChIKey | NNXNJTORWJCPAC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline?
The IUPAC name of 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline (CID 21393808) is 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline?
The canonical SMILES for 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline is O=[N+]([O-])c1ccc2c(c1Cl)CNCC2.
What is the InChIKey of 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline?
The InChIKey is NNXNJTORWJCPAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O2/c10-9-7-5-11-4-3-6(7)1-2-8(9)12(13)14/h1-2,11H,3-5H2.
What are the key properties of 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline?
8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline has a molecular weight of 212.64 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-7-nitro-1,2,3,4-tetrahydroisoquinoline is sourced from PubChem (CID 21393808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).