C21H42BrN2- — CID 21393920
2-ethyl-1,3-dioctyl-2H-imidazole bromide (PubChem CID 21393920) has the molecular formula C21H42BrN2- and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-ethyl-1,3-dioctyl-2H-imidazole bromide.
| Compound Name | 2-ethyl-1,3-dioctyl-2H-imidazole bromide |
|---|---|
| PubChem CID | 21393920 |
| Molecular Formula | C21H42BrN2- |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 2-ethyl-1,3-dioctyl-2H-imidazole bromide |
| SMILES | CCCCCCCCN1C=CN(CCCCCCCC)C1CC.[Br-] |
| InChI | InChI=1S/C21H42N2.BrH/c1-4-7-9-11-13-15-17-22-19-20-23(21(22)6-3)18-16-14-12-10-8-5-2;/h19-21H,4-18H2,1-3H3;1H/p-1 |
| InChIKey | RNMSXMJROFRXGT-UHFFFAOYSA-M |
| XLogP | 3.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|