About 2,6-dibromo-4-chlorophenol
2,6-dibromo-4-chlorophenol (PubChem CID 21394) has the molecular formula C6H3Br2ClO
and a molecular weight of 286.35 g/mol. Its IUPAC name is 2,6-dibromo-4-chlorophenol.
Molecular Properties
| Compound Name | 2,6-dibromo-4-chlorophenol |
| PubChem CID | 21394 |
| Molecular Formula | C6H3Br2ClO |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 283.82 |
| IUPAC Name | 2,6-dibromo-4-chlorophenol |
| SMILES | Oc1c(Br)cc(Cl)cc1Br |
| InChI | InChI=1S/C6H3Br2ClO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H |
| InChIKey | WYZQOLPTPZDTIF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dibromo-4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-chlorophenol?
The IUPAC name of 2,6-dibromo-4-chlorophenol (CID 21394) is 2,6-dibromo-4-chlorophenol.
What is the SMILES notation for 2,6-dibromo-4-chlorophenol?
The canonical SMILES for 2,6-dibromo-4-chlorophenol is Oc1c(Br)cc(Cl)cc1Br.
What is the InChIKey of 2,6-dibromo-4-chlorophenol?
The InChIKey is WYZQOLPTPZDTIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br2ClO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H.
What are the key properties of 2,6-dibromo-4-chlorophenol?
2,6-dibromo-4-chlorophenol has a molecular weight of 286.35 g/mol, XLogP of 3.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-chlorophenol is sourced from PubChem (CID 21394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).