About 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide
2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide (PubChem CID 21394500) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide.
Molecular Properties
| Compound Name | 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide |
| PubChem CID | 21394500 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide |
| SMILES | CC1(C)CS(=O)(=O)CC2(CCCCC2)N1 |
| InChI | InChI=1S/C11H21NO2S/c1-10(2)8-15(13,14)9-11(12-10)6-4-3-5-7-11/h12H,3-9H2,1-2H3 |
| InChIKey | URALBIKJUMVAPJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide?
The IUPAC name of 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide (CID 21394500) is 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide.
What is the SMILES notation for 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide?
The canonical SMILES for 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide is CC1(C)CS(=O)(=O)CC2(CCCCC2)N1.
What is the InChIKey of 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide?
The InChIKey is URALBIKJUMVAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2S/c1-10(2)8-15(13,14)9-11(12-10)6-4-3-5-7-11/h12H,3-9H2,1-2H3.
What are the key properties of 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide?
2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide has a molecular weight of 231.36 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4λ6-thia-1-azaspiro[5.5]undecane 4,4-dioxide is sourced from PubChem (CID 21394500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).