About 4-cyclohexylisoquinoline
4-cyclohexylisoquinoline (PubChem CID 21394649) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-cyclohexylisoquinoline.
Molecular Properties
| Compound Name | 4-cyclohexylisoquinoline |
| PubChem CID | 21394649 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 4-cyclohexylisoquinoline |
| SMILES | c1ccc2c(C3CCCCC3)cncc2c1 |
| InChI | InChI=1S/C15H17N/c1-2-6-12(7-3-1)15-11-16-10-13-8-4-5-9-14(13)15/h4-5,8-12H,1-3,6-7H2 |
| InChIKey | PMIPXYHTJCMBJU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylisoquinoline?
The IUPAC name of 4-cyclohexylisoquinoline (CID 21394649) is 4-cyclohexylisoquinoline.
What is the SMILES notation for 4-cyclohexylisoquinoline?
The canonical SMILES for 4-cyclohexylisoquinoline is c1ccc2c(C3CCCCC3)cncc2c1.
What is the InChIKey of 4-cyclohexylisoquinoline?
The InChIKey is PMIPXYHTJCMBJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N/c1-2-6-12(7-3-1)15-11-16-10-13-8-4-5-9-14(13)15/h4-5,8-12H,1-3,6-7H2.
What are the key properties of 4-cyclohexylisoquinoline?
4-cyclohexylisoquinoline has a molecular weight of 211.31 g/mol, XLogP of 4.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylisoquinoline is sourced from PubChem (CID 21394649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).