C15H21Cl2N3O3S2 — CID 21394801
2,3-dichloro-5-(4-hydroxy-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-yl)benzenesulfonamide (PubChem CID 21394801) has the molecular formula C15H21Cl2N3O3S2 and a molecular weight of 426.39 g/mol. Its IUPAC name is 2,3-dichloro-5-(4-hydroxy-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-yl)benzenesulfonamide.
| Compound Name | 2,3-dichloro-5-(4-hydroxy-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 21394801 |
| Molecular Formula | C15H21Cl2N3O3S2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2,3-dichloro-5-(4-hydroxy-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-yl)benzenesulfonamide |
| SMILES | CC(C)/N=C1\SCC(O)(c2cc(Cl)c(Cl)c(S(N)(=O)=O)c2)N1C(C)C |
| InChI | InChI=1S/C15H21Cl2N3O3S2/c1-8(2)19-14-20(9(3)4)15(21,7-24-14)10-5-11(16)13(17)12(6-10)25(18,22)23/h5-6,8-9,21H,7H2,1-4H3,(H2,18,22,23)/b19-14- |
| InChIKey | STNCOLSUXDTDIS-RGEXLXHISA-N |
| XLogP | 3.01 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|