C17H24N4O5S3 — CID 21394846
[3-(5-hexylsulfonyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] thiophene-2-carboxylate (PubChem CID 21394846) has the molecular formula C17H24N4O5S3 and a molecular weight of 460.60 g/mol. Its IUPAC name is [3-(5-hexylsulfonyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] thiophene-2-carboxylate.
| Compound Name | [3-(5-hexylsulfonyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 21394846 |
| Molecular Formula | C17H24N4O5S3 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | [3-(5-hexylsulfonyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] thiophene-2-carboxylate |
| SMILES | CCCCCCS(=O)(=O)c1nnc([N+]2([O-])CN(C)CC2OC(=O)c2cccs2)s1 |
| InChI | InChI=1S/C17H24N4O5S3/c1-3-4-5-6-10-29(24,25)17-19-18-16(28-17)21(23)12-20(2)11-14(21)26-15(22)13-8-7-9-27-13/h7-9,14H,3-6,10-12H2,1-2H3 |
| InChIKey | HJRAKJGQTPJYEZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|