About 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid
3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid (PubChem CID 21395554) has the molecular formula C22H42O4S
and a molecular weight of 402.64 g/mol. Its IUPAC name is 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid |
| PubChem CID | 21395554 |
| Molecular Formula | C22H42O4S |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid |
| SMILES | CCC(C(=O)O)C(CCSCCC(C(CC)C(=O)O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H42O4S/c1-9-15(19(23)24)17(21(3,4)5)11-13-27-14-12-18(22(6,7)8)16(10-2)20(25)26/h15-18H,9-14H2,1-8H3,(H,23,24)(H,25,26) |
| InChIKey | CDNFCALTSAIAHP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid?
The IUPAC name of 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid (CID 21395554) is 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid.
What is the SMILES notation for 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid?
The canonical SMILES for 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid is CCC(C(=O)O)C(CCSCCC(C(CC)C(=O)O)C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid?
The InChIKey is CDNFCALTSAIAHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O4S/c1-9-15(19(23)24)17(21(3,4)5)11-13-27-14-12-18(22(6,7)8)16(10-2)20(25)26/h15-18H,9-14H2,1-8H3,(H,23,24)(H,25,26).
What are the key properties of 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid?
3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid has a molecular weight of 402.64 g/mol, XLogP of 6.05, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-tert-butyl-4-carboxyhexyl)sulfanylethyl]-2-ethyl-4,4-dimethylpentanoic acid is sourced from PubChem (CID 21395554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).