About N-benzylthieno[2,3-d]pyrimidin-4-amine
N-benzylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 2139597) has the molecular formula C13H11N3S
and a molecular weight of 241.32 g/mol. Its IUPAC name is N-benzylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-benzylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 2139597 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-benzylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc(CNc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C13H11N3S/c1-2-4-10(5-3-1)8-14-12-11-6-7-17-13(11)16-9-15-12/h1-7,9H,8H2,(H,14,15,16) |
| InChIKey | KAWLVBDVIYJPHS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-benzylthieno[2,3-d]pyrimidin-4-amine (CID 2139597) is N-benzylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-benzylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-benzylthieno[2,3-d]pyrimidin-4-amine is c1ccc(CNc2ncnc3sccc23)cc1.
What is the InChIKey of N-benzylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is KAWLVBDVIYJPHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3S/c1-2-4-10(5-3-1)8-14-12-11-6-7-17-13(11)16-9-15-12/h1-7,9H,8H2,(H,14,15,16).
What are the key properties of N-benzylthieno[2,3-d]pyrimidin-4-amine?
N-benzylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 241.32 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 2139597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).