About N-methyl-1,2-benzodiazepin-2-amine
N-methyl-1,2-benzodiazepin-2-amine (PubChem CID 21396036) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is N-methyl-1,2-benzodiazepin-2-amine.
Molecular Properties
| Compound Name | N-methyl-1,2-benzodiazepin-2-amine |
| PubChem CID | 21396036 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N-methyl-1,2-benzodiazepin-2-amine |
| SMILES | CNN1C=CC=c2ccccc2=N1 |
| InChI | InChI=1S/C10H11N3/c1-11-13-8-4-6-9-5-2-3-7-10(9)12-13/h2-8,11H,1H3 |
| InChIKey | OLBFEJJRUZJXFX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1,2-benzodiazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,2-benzodiazepin-2-amine?
The IUPAC name of N-methyl-1,2-benzodiazepin-2-amine (CID 21396036) is N-methyl-1,2-benzodiazepin-2-amine.
What is the SMILES notation for N-methyl-1,2-benzodiazepin-2-amine?
The canonical SMILES for N-methyl-1,2-benzodiazepin-2-amine is CNN1C=CC=c2ccccc2=N1.
What is the InChIKey of N-methyl-1,2-benzodiazepin-2-amine?
The InChIKey is OLBFEJJRUZJXFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-11-13-8-4-6-9-5-2-3-7-10(9)12-13/h2-8,11H,1H3.
What are the key properties of N-methyl-1,2-benzodiazepin-2-amine?
N-methyl-1,2-benzodiazepin-2-amine has a molecular weight of 173.22 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,2-benzodiazepin-2-amine is sourced from PubChem (CID 21396036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).