About 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine
7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine (PubChem CID 21396041) has the molecular formula C18H16ClN3O
and a molecular weight of 325.80 g/mol. Its IUPAC name is 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine.
Molecular Properties
| Compound Name | 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine |
| PubChem CID | 21396041 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine |
| SMILES | C=CC/N=C1/CN(O)C(c2ccccc2)=c2cc(Cl)ccc2=N1 |
| InChI | InChI=1S/C18H16ClN3O/c1-2-10-20-17-12-22(23)18(13-6-4-3-5-7-13)15-11-14(19)8-9-16(15)21-17/h2-9,11,23H,1,10,12H2/b20-17- |
| InChIKey | VWAXPKAETHBVLH-JZJYNLBNSA-N |
| XLogP | 2.41 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine?
The IUPAC name of 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine (CID 21396041) is 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine.
What is the SMILES notation for 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine?
The canonical SMILES for 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine is C=CC/N=C1/CN(O)C(c2ccccc2)=c2cc(Cl)ccc2=N1.
What is the InChIKey of 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine?
The InChIKey is VWAXPKAETHBVLH-JZJYNLBNSA-N. The full InChI is InChI=1S/C18H16ClN3O/c1-2-10-20-17-12-22(23)18(13-6-4-3-5-7-13)15-11-14(19)8-9-16(15)21-17/h2-9,11,23H,1,10,12H2/b20-17-.
What are the key properties of 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine?
7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine has a molecular weight of 325.80 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-hydroxy-5-phenyl-N-prop-2-enyl-3H-1,4-benzodiazepin-2-imine is sourced from PubChem (CID 21396041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).