About 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid
3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid (PubChem CID 21396448) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid.
Molecular Properties
| Compound Name | 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid |
| PubChem CID | 21396448 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid |
| SMILES | CC1=CC2(c3ccccc31)C(C)C2C(=O)O |
| InChI | InChI=1S/C14H14O2/c1-8-7-14(9(2)12(14)13(15)16)11-6-4-3-5-10(8)11/h3-7,9,12H,1-2H3,(H,15,16) |
| InChIKey | CEYHNSOUZSTVMF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid?
The IUPAC name of 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid (CID 21396448) is 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid.
What is the SMILES notation for 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid?
The canonical SMILES for 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid is CC1=CC2(c3ccccc31)C(C)C2C(=O)O.
What is the InChIKey of 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid?
The InChIKey is CEYHNSOUZSTVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2/c1-8-7-14(9(2)12(14)13(15)16)11-6-4-3-5-10(8)11/h3-7,9,12H,1-2H3,(H,15,16).
What are the key properties of 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid?
3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid has a molecular weight of 214.26 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3'-dimethylspiro[cyclopropane-2,1'-indene]-1-carboxylic acid is sourced from PubChem (CID 21396448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).