About N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine
N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine (PubChem CID 21396652) has the molecular formula C29H59N3
and a molecular weight of 449.81 g/mol. Its IUPAC name is N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine |
| PubChem CID | 21396652 |
| Molecular Formula | C29H59N3 |
| Molecular Weight | 449.81 g/mol |
| Exact Mass | 449.47 |
| IUPAC Name | N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine |
| SMILES | CC(C)C1CCC(CCC(CCC2CCC(C(C)C)CC2)NCCCNCCCN)CC1 |
| InChI | InChI=1S/C29H59N3/c1-23(2)27-13-7-25(8-14-27)11-17-29(32-22-6-21-31-20-5-19-30)18-12-26-9-15-28(16-10-26)24(3)4/h23-29,31-32H,5-22,30H2,1-4H3 |
| InChIKey | PCBZQKZZJOZLLW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.81 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine?
The IUPAC name of N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine (CID 21396652) is N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine.
What is the SMILES notation for N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine?
The canonical SMILES for N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine is CC(C)C1CCC(CCC(CCC2CCC(C(C)C)CC2)NCCCNCCCN)CC1.
What is the InChIKey of N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine?
The InChIKey is PCBZQKZZJOZLLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H59N3/c1-23(2)27-13-7-25(8-14-27)11-17-29(32-22-6-21-31-20-5-19-30)18-12-26-9-15-28(16-10-26)24(3)4/h23-29,31-32H,5-22,30H2,1-4H3.
What are the key properties of N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine?
N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine has a molecular weight of 449.81 g/mol, XLogP of 6.76, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-[1,5-bis(4-propan-2-ylcyclohexyl)pentan-3-ylamino]propyl]propane-1,3-diamine is sourced from PubChem (CID 21396652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).