C29H55N3 — CID 21396655
N'-[3-[2,8-bis(4-methylcyclohex-3-en-1-yl)nonan-5-ylamino]propyl]propane-1,3-diamine (PubChem CID 21396655) has the molecular formula C29H55N3 and a molecular weight of 445.78 g/mol. Its IUPAC name is N'-[3-[2,8-bis(4-methylcyclohex-3-en-1-yl)nonan-5-ylamino]propyl]propane-1,3-diamine.
| Compound Name | N'-[3-[2,8-bis(4-methylcyclohex-3-en-1-yl)nonan-5-ylamino]propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 21396655 |
| Molecular Formula | C29H55N3 |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 445.44 |
| IUPAC Name | N'-[3-[2,8-bis(4-methylcyclohex-3-en-1-yl)nonan-5-ylamino]propyl]propane-1,3-diamine |
| SMILES | CC1=CCC(C(C)CCC(CCC(C)C2CC=C(C)CC2)NCCCNCCCN)CC1 |
| InChI | InChI=1S/C29H55N3/c1-23-7-13-27(14-8-23)25(3)11-17-29(32-22-6-21-31-20-5-19-30)18-12-26(4)28-15-9-24(2)10-16-28/h7,9,25-29,31-32H,5-6,8,10-22,30H2,1-4H3 |
| InChIKey | FOLOJGZNFIAOMR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|