C29H56N4 — CID 21396683
N'-[2-[2-[1,5-bis(4-propan-2-ylcyclohexen-1-yl)pentan-3-ylamino]ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 21396683) has the molecular formula C29H56N4 and a molecular weight of 460.80 g/mol. Its IUPAC name is N'-[2-[2-[1,5-bis(4-propan-2-ylcyclohexen-1-yl)pentan-3-ylamino]ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-[1,5-bis(4-propan-2-ylcyclohexen-1-yl)pentan-3-ylamino]ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 21396683 |
| Molecular Formula | C29H56N4 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.45 |
| IUPAC Name | N'-[2-[2-[1,5-bis(4-propan-2-ylcyclohexen-1-yl)pentan-3-ylamino]ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | CC(C)C1CC=C(CCC(CCC2=CCC(C(C)C)CC2)NCCNCCNCCN)CC1 |
| InChI | InChI=1S/C29H56N4/c1-23(2)27-11-5-25(6-12-27)9-15-29(33-22-21-32-20-19-31-18-17-30)16-10-26-7-13-28(14-8-26)24(3)4/h5,7,23-24,27-29,31-33H,6,8-22,30H2,1-4H3 |
| InChIKey | MZVUTDVIEXZREL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|