About 3-undecylpyrrole-2,5-dione
3-undecylpyrrole-2,5-dione (PubChem CID 21396932) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-undecylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-undecylpyrrole-2,5-dione |
| PubChem CID | 21396932 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 3-undecylpyrrole-2,5-dione |
| SMILES | CCCCCCCCCCCC1=CC(=O)NC1=O |
| InChI | InChI=1S/C15H25NO2/c1-2-3-4-5-6-7-8-9-10-11-13-12-14(17)16-15(13)18/h12H,2-11H2,1H3,(H,16,17,18) |
| InChIKey | AIDMZXDPDDYOKL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-undecylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-undecylpyrrole-2,5-dione?
The IUPAC name of 3-undecylpyrrole-2,5-dione (CID 21396932) is 3-undecylpyrrole-2,5-dione.
What is the SMILES notation for 3-undecylpyrrole-2,5-dione?
The canonical SMILES for 3-undecylpyrrole-2,5-dione is CCCCCCCCCCCC1=CC(=O)NC1=O.
What is the InChIKey of 3-undecylpyrrole-2,5-dione?
The InChIKey is AIDMZXDPDDYOKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2/c1-2-3-4-5-6-7-8-9-10-11-13-12-14(17)16-15(13)18/h12H,2-11H2,1H3,(H,16,17,18).
What are the key properties of 3-undecylpyrrole-2,5-dione?
3-undecylpyrrole-2,5-dione has a molecular weight of 251.37 g/mol, XLogP of 3.49, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-undecylpyrrole-2,5-dione is sourced from PubChem (CID 21396932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).