About N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine
N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 21397100) has the molecular formula C6H11ClN2
and a molecular weight of 146.62 g/mol. Its IUPAC name is N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 21397100 |
| Molecular Formula | C6H11ClN2 |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CC(Cl)NC1=NCCC1 |
| InChI | InChI=1S/C6H11ClN2/c1-5(7)9-6-3-2-4-8-6/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | XOQDALQRGXQHED-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine (CID 21397100) is N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine is CC(Cl)NC1=NCCC1.
What is the InChIKey of N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is XOQDALQRGXQHED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClN2/c1-5(7)9-6-3-2-4-8-6/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine?
N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 146.62 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloroethyl)-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 21397100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).