About 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide
1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide (PubChem CID 21397133) has the molecular formula C8H19Br3N2
and a molecular weight of 382.97 g/mol. Its IUPAC name is 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide.
Molecular Properties
| Compound Name | 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide |
| PubChem CID | 21397133 |
| Molecular Formula | C8H19Br3N2 |
| Molecular Weight | 382.97 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide |
| SMILES | Br.Br.CCC(Br)N1CCN(C)CC1 |
| InChI | InChI=1S/C8H17BrN2.2BrH/c1-3-8(9)11-6-4-10(2)5-7-11;;/h8H,3-7H2,1-2H3;2*1H |
| InChIKey | RKQOODXMVRGROV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.97 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide?
The IUPAC name of 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide (CID 21397133) is 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide.
What is the SMILES notation for 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide?
The canonical SMILES for 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide is Br.Br.CCC(Br)N1CCN(C)CC1.
What is the InChIKey of 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide?
The InChIKey is RKQOODXMVRGROV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BrN2.2BrH/c1-3-8(9)11-6-4-10(2)5-7-11;;/h8H,3-7H2,1-2H3;2*1H.
What are the key properties of 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide?
1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide has a molecular weight of 382.97 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-bromopropyl)-4-methylpiperazine;dihydrobromide is sourced from PubChem (CID 21397133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).