About 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one
4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one (PubChem CID 21397287) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one.
Molecular Properties
| Compound Name | 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one |
| PubChem CID | 21397287 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one |
| SMILES | CCCCCCC1OC(OC)C2OC2C1=O |
| InChI | InChI=1S/C12H20O4/c1-3-4-5-6-7-8-9(13)10-11(16-10)12(14-2)15-8/h8,10-12H,3-7H2,1-2H3 |
| InChIKey | IUCHKCADBOOSBB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one?
The IUPAC name of 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one (CID 21397287) is 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one.
What is the SMILES notation for 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one?
The canonical SMILES for 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one is CCCCCCC1OC(OC)C2OC2C1=O.
What is the InChIKey of 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one?
The InChIKey is IUCHKCADBOOSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-3-4-5-6-7-8-9(13)10-11(16-10)12(14-2)15-8/h8,10-12H,3-7H2,1-2H3.
What are the key properties of 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one?
4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one has a molecular weight of 228.29 g/mol, XLogP of 1.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-one is sourced from PubChem (CID 21397287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).