About (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate
(4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate (PubChem CID 21397299) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate.
Molecular Properties
| Compound Name | (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate |
| PubChem CID | 21397299 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate |
| SMILES | CCCCCCCCC1OC(OC(C)=O)C2OC2C1=O |
| InChI | InChI=1S/C15H24O5/c1-3-4-5-6-7-8-9-11-12(17)13-14(20-13)15(19-11)18-10(2)16/h11,13-15H,3-9H2,1-2H3 |
| InChIKey | BLANHKLOWLGAFA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate?
The IUPAC name of (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate (CID 21397299) is (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate.
What is the SMILES notation for (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate?
The canonical SMILES for (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate is CCCCCCCCC1OC(OC(C)=O)C2OC2C1=O.
What is the InChIKey of (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate?
The InChIKey is BLANHKLOWLGAFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O5/c1-3-4-5-6-7-8-9-11-12(17)13-14(20-13)15(19-11)18-10(2)16/h11,13-15H,3-9H2,1-2H3.
What are the key properties of (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate?
(4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate has a molecular weight of 284.35 g/mol, XLogP of 2.36, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-octyl-5-oxo-3,7-dioxabicyclo[4.1.0]heptan-2-yl) acetate is sourced from PubChem (CID 21397299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).